benzene-1,2-diol,boric acid,2-methylpentane-2,4-diol structure
|
Common Name | benzene-1,2-diol,boric acid,2-methylpentane-2,4-diol | ||
|---|---|---|---|---|
| CAS Number | 72275-80-0 | Molecular Weight | 290.11800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H23BO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzene-1,2-diol,boric acid,2-methylpentane-2,4-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H23BO7 |
|---|---|
| Molecular Weight | 290.11800 |
| Exact Mass | 290.15400 |
| PSA | 141.61000 |
| InChIKey | OPYCBSDLMOGOMH-UHFFFAOYSA-N |
| SMILES | CC(O)CC(C)(C)O.OB(O)O.Oc1ccccc1O |
| Boric acid (H3BO3),mixed esters with 2-methyl-2,4-pentanediol and pyrocatechol |
| Boric acid,mixed esters with 1,2-benzenediol and 2-methyl-2,4-pentanediol |