ethyl prop-2-enoate,2-hydroxyethyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid structure
|
Common Name | ethyl prop-2-enoate,2-hydroxyethyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 72275-83-3 | Molecular Weight | 316.34700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl prop-2-enoate,2-hydroxyethyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H24O7 |
|---|---|
| Molecular Weight | 316.34700 |
| Exact Mass | 316.15200 |
| PSA | 110.13000 |
| LogP | 1.48060 |
| InChIKey | KCUBDWDSHMYQLL-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OCCO.C=CC(=O)OCC |
| 2-Propenoic acid,2-methyl-,polymers with Et acrylate and polyethylene glycol methacrylate C12-14-alkyl ethers |
| 2-Propenoic acid,2-methyl-,polymers with Et acrylate and polyethylene glycol monomethacrylate C12-14-alkyl ethers |