2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid
2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid structure
|
Common Name | 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 723-76-2 | Molecular Weight | 232.19200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8N2O4 |
|---|---|
| Molecular Weight | 232.19200 |
| Exact Mass | 232.04800 |
| PSA | 92.16000 |
| LogP | 0.22400 |
| InChIKey | ZBLBTVNWNGWGHA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(=O)n(-c2ccccc2)c(=O)[nH]1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:4260-40-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,6-Dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidin-4-carbonsaeure |
| 3-Phenylorotsaeure |
| 3-Phenyl-orotsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid? |
| A: SMILES notation of 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid is O=C(O)c1cc(=O)n(-c2ccccc2)c(=O)[nH]1. |
| Q: What is the molecular formula of 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid? |
| A: Molecular formula of 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid is C11H8N2O4. |
| Q: What is the polar surface area (PSA) of 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid? |
| A: Polar surface area (PSA) of 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid is 92.16000. |
| Q: What is the CAS number of 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid? |
| A: CAS number of 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid is 723-76-2. |
| Q: What is the Chinese name of 723-76-2? |
| A: Chinese name of 723-76-2 is 723-76-2. |
| Q: What is the InChIKey of 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid? |
| A: InChIKey of 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid is ZBLBTVNWNGWGHA-UHFFFAOYSA-N. |
| Q: What is the LogP of 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid? |
| A: LogP of 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid is 0.22400. |
| Q: What is the molecular weight of 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid? |
| A: Molecular weight of 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid is 232.19200. |
| Q: What are the downstream products of 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid? |
| A: Related downstream products(CAS) of 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid: 4260-40-6. |
| Q: What is the English name of 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid? |
| A: The English name of 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid is 2,6-dioxo-1-phenyl-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |