phenyl [(4-chlorophenoxy)-ethoxyphosphoryl]formate
Modify Date: 2025-09-21 07:33:24
![phenyl [(4-chlorophenoxy)-ethoxyphosphoryl]formate Structure](https://image.chemsrc.com/caspic/254/72304-85-9.png)
phenyl [(4-chlorophenoxy)-ethoxyphosphoryl]formate structure
|
Common Name | phenyl [(4-chlorophenoxy)-ethoxyphosphoryl]formate | ||
|---|---|---|---|---|
| CAS Number | 72304-85-9 | Molecular Weight | 340.69500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14ClO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenyl [(4-chlorophenoxy)-ethoxyphosphoryl]formate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14ClO5P |
|---|---|
| Molecular Weight | 340.69500 |
| Exact Mass | 340.02700 |
| PSA | 71.64000 |
| LogP | 5.14740 |
| InChIKey | DULOPIOHIVOMNX-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(Oc1ccc(Cl)cc1)C(=O)Oc1ccccc1 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:74270-22-7
CAS#:4428-95-9|
Name: Evaluated for antiviral activity against cutaneous HSV-1 C42 infections in guinea pig...
Source: ChEMBL
Target: Human alphaherpesvirus 1
External Id: CHEMBL689926
|
|
Name: Concentration required for 50% inhibition of of HSV-1 DNA polymerase in HSV -1 C42 pl...
Source: ChEMBL
Target: Nucleic Acid
External Id: CHEMBL662229
|
Total 2, Current Page 1 of 1
1
| Phosphinecarboxylic acid,(4-chlorophenoxy)ethoxy-,phenyl ester,oxide |
| phenyl (4-chlorophenoxy)(ethoxy)phosphinecarboxylate oxide |