2-(2-((tert-Butoxycarbonyl)amino)thiazol-5-yl)acetic acid structure
|
Common Name | 2-(2-((tert-Butoxycarbonyl)amino)thiazol-5-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 723278-39-5 | Molecular Weight | 258.294 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-((tert-Butoxycarbonyl)amino)thiazol-5-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.294 |
| Exact Mass | 258.067413 |
| PSA | 116.76000 |
| LogP | 1.16 |
| Index of Refraction | 1.591 |
| InChIKey | HURLAKSDAZFWSW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ncc(CC(=O)O)s1 |
| HS Code | 2934100090 |
|---|
|
~76%
2-(2-((tert-But... CAS#:723278-39-5 |
| Literature: ASTRAZENECA AB; ASTRAZENECA UK LIMITED Patent: WO2004/58752 A1, 2004 ; Location in patent: Page 67 ; WO 2004/058752 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-Thiazoleacetic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| {2-[(tert-Butoxycarbonyl)amino]-1,3-thiazol-5-yl}acetic acid |
| 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-5-yl]acetic acid |
| [2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-1,3-thiazol-5-yl]acetic acid |