tert-butyl 3-methoxy-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazine-7(8H)-carboxylate structure
|
Common Name | tert-butyl 3-methoxy-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazine-7(8H)-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 723286-81-5 | Molecular Weight | 254.28600 | |
| Density | 1.29g/cm3 | Boiling Point | 401ºC at 760 mmHg | |
| Molecular Formula | C11H18N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.3ºC | |
| Name | tert-butyl 3-methoxy-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 401ºC at 760 mmHg |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.28600 |
| Flash Point | 196.3ºC |
| Exact Mass | 254.13800 |
| PSA | 69.48000 |
| LogP | 0.97530 |
| Index of Refraction | 1.584 |
| InChIKey | QVUNVQZUXIJMJK-UHFFFAOYSA-N |
| SMILES | COc1nnc2n1CCN(C(=O)OC(C)(C)C)C2 |
| HS Code | 2933990090 |
|---|
|
~%
tert-butyl 3-me... CAS#:723286-81-5 |
| Literature: MERCK and CO., INC. Patent: WO2004/58266 A1, 2004 ; Location in patent: Page/Page column 80 ; WO 2004/058266 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |