4-N-dianilinophosphanyl-2-N,4-N,1,3-tetraphenyl-1,3,2,4-diazadiphosphetidine-2,4-diamine structure
|
Common Name | 4-N-dianilinophosphanyl-2-N,4-N,1,3-tetraphenyl-1,3,2,4-diazadiphosphetidine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 7235-21-4 | Molecular Weight | 642.60900 | |
| Density | N/A | Boiling Point | 710.8ºC at 760mmHg | |
| Molecular Formula | C36H33N6P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 383.7ºC | |
| Name | 4-N-dianilinophosphanyl-2-N,4-N,1,3-tetraphenyl-1,3,2,4-diazadiphosphetidine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 710.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C36H33N6P3 |
| Molecular Weight | 642.60900 |
| Flash Point | 383.7ºC |
| Exact Mass | 642.19800 |
| PSA | 62.78000 |
| LogP | 11.61840 |
| InChIKey | FKRCKRQDGIZRNJ-UHFFFAOYSA-N |
| SMILES | c1ccc(NP(Nc2ccccc2)N(c2ccccc2)P2N(c3ccccc3)P(Nc3ccccc3)N2c2ccccc2)cc1 |
|
~58%
4-N-dianilinoph... CAS#:7235-21-4 |
| Literature: Allahyari-Devin, Maryam; Abedi, Behnam; Navidpour, Latifeh; Shafiee, Abbas Journal of the Iranian Chemical Society, 2013 , vol. 10, # 1 p. 43 - 53 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-acetyl-5-methoxy-2,3-dihydro-1H-inden-1-one |