Laetanine
Modify Date: 2025-08-26 17:07:12
Laetanine structure
|
Common Name | Laetanine | ||
|---|---|---|---|---|
| CAS Number | 72361-67-2 | Molecular Weight | 313.348 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 551.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.0±30.1 °C | |
Use of LaetanineLaetanine, a noraporphine alkaloid from Litsea laeta, exhibits antiplasmodial activity[1]. |
| Name | (6aS)-1,9-Dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,10-diol |
|---|---|
| Synonym | More Synonyms |
| Description | Laetanine, a noraporphine alkaloid from Litsea laeta, exhibits antiplasmodial activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 551.0±50.0 °C at 760 mmHg |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.348 |
| Flash Point | 287.0±30.1 °C |
| Exact Mass | 313.131409 |
| LogP | 1.43 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | URQAEFLEDPPPFX-LBPRGKRZSA-N |
| SMILES | COc1cc2c(cc1O)-c1c(OC)c(O)cc3c1C(C2)NCC3 |
| (6aS)-1,9-Dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,10-diol |
| 4H-Dibenzo[de,g]quinoline-2,10-diol, 5,6,6a,7-tetrahydro-1,9-dimethoxy-, (6aS)- |