5-O-Benzyl-D-ribose structure
|
Common Name | 5-O-Benzyl-D-ribose | ||
|---|---|---|---|---|
| CAS Number | 72369-89-2 | Molecular Weight | 240.25200 | |
| Density | 1.37g/cm3 | Boiling Point | 425.734ºC at 760 mmHg | |
| Molecular Formula | C12H16O5 | Melting Point | 75-76ºC | |
| MSDS | N/A | Flash Point | 211.277ºC | |
| Name | (2R,3R,4R)-2,3,4-trihydroxy-5-phenylmethoxypentanal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 425.734ºC at 760 mmHg |
| Melting Point | 75-76ºC |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25200 |
| Flash Point | 211.277ºC |
| Exact Mass | 240.10000 |
| PSA | 86.99000 |
| Index of Refraction | 1.605 |
| InChIKey | SMERYXWDIUSMOF-TUAOUCFPSA-N |
| SMILES | O=CC(O)C(O)C(O)COCc1ccccc1 |
|
~%
5-O-Benzyl-D-ribose CAS#:72369-89-2 |
| Literature: Journal of the Chemical Society, , p. 1613,1616 |
|
~%
5-O-Benzyl-D-ribose CAS#:72369-89-2 |
| Literature: Journal of the Chemical Society, , p. 1613,1616 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| D-Ribose,5-O-(phenylmethyl) |
| O5-Benzyl-ribose |