Hepronicate structure
|
Common Name | Hepronicate | ||
|---|---|---|---|---|
| CAS Number | 7237-81-2 | Molecular Weight | 505.56200 | |
| Density | 1.203 g/cm3 | Boiling Point | 661.3ºC at 760 mmHg | |
| Molecular Formula | C28H31N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 353.7ºC | |
Use of HepronicateHepronicate is a peripheral vasodilator with blood lipid lowering action. |
| Name | 2,2-bis(pyridine-3-carbonyloxymethyl)octyl pyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Hepronicate is a peripheral vasodilator with blood lipid lowering action. |
|---|---|
| Related Catalog |
| Density | 1.203 g/cm3 |
|---|---|
| Boiling Point | 661.3ºC at 760 mmHg |
| Molecular Formula | C28H31N3O6 |
| Molecular Weight | 505.56200 |
| Flash Point | 353.7ºC |
| Exact Mass | 505.22100 |
| PSA | 117.57000 |
| LogP | 4.69920 |
| Index of Refraction | 1.563 |
| InChIKey | GUIBJJJLGSYNKE-UHFFFAOYSA-N |
| SMILES | CCCCCCC(COC(=O)c1cccnc1)(COC(=O)c1cccnc1)COC(=O)c1cccnc1 |
| Storage condition | 2-8℃ |
| 2-Hydroxymethyl-2-hexyl-1,3-propanediol trinicotinate |
| Hepronicatum [INN-Latin] |
| Hepronicato [INN-Spanish] |
| hepronicate(jan) |
| Megrin |
| Hepronicat |
| hepronicate |
| CLY 115 |