3,6-diphenyl-1,2,4,5-tetraoxane,tris(2-methylphenyl) phosphate structure
|
Common Name | 3,6-diphenyl-1,2,4,5-tetraoxane,tris(2-methylphenyl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 72378-88-2 | Molecular Weight | 612.60500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H33O8P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,6-diphenyl-1,2,4,5-tetraoxane,tris(2-methylphenyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C35H33O8P |
|---|---|
| Molecular Weight | 612.60500 |
| Exact Mass | 612.19100 |
| PSA | 91.49000 |
| LogP | 9.55070 |
| InChIKey | CMYREPOYIOIDFH-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1OP(=O)(Oc1ccccc1C)Oc1ccccc1C.c1ccc(C2OOC(c3ccccc3)OO2)cc1 |
| s-Tetroxane,3,6-diphenyl-compd. with tritolylphosphate (1:1) |
| Phosphoric acid,tritolyl ester compd. with 3,6-diphenyl-s-tetroxane (1:1) |
| s-Teroxane,3,6-diphenyl-with x-tolyl phosphate,tri-(1:1) |
| 3,6-diphenyl-1,2,4,5-tetraoxane |