tris(3,5,5-trimethylhexyl) phosphate
tris(3,5,5-trimethylhexyl) phosphate structure
|
Common Name | tris(3,5,5-trimethylhexyl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 72386-53-9 | Molecular Weight | 476.71300 | |
| Density | 0.919g/cm3 | Boiling Point | 497.1ºC at 760 mmHg | |
| Molecular Formula | C27H57O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tris(3,5,5-trimethylhexyl) phosphate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.919g/cm3 |
|---|---|
| Boiling Point | 497.1ºC at 760 mmHg |
| Molecular Formula | C27H57O4P |
| Molecular Weight | 476.71300 |
| Flash Point | 267.5ºC |
| Exact Mass | 476.39900 |
| PSA | 54.57000 |
| LogP | 9.53150 |
| Index of Refraction | 1.448 |
| InChIKey | XJLVCRZMJZCMTG-UHFFFAOYSA-N |
| SMILES | CC(CCOP(=O)(OCCC(C)CC(C)(C)C)OCCC(C)CC(C)(C)C)CC(C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
tris(3,5,5-trim... CAS#:72386-53-9 |
| Literature: Goodrich Co. Patent: US2650908 , 1951 ; |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| einecs 276-626-5 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of tris(3,5,5-trimethylhexyl) phosphate? |
| A: SMILES notation of tris(3,5,5-trimethylhexyl) phosphate is CC(CCOP(=O)(OCCC(C)CC(C)(C)C)OCCC(C)CC(C)(C)C)CC(C)(C)C. |
| Q: What is the English name of tris(3,5,5-trimethylhexyl) phosphate? |
| A: The English name of tris(3,5,5-trimethylhexyl) phosphate is tris(3,5,5-trimethylhexyl) phosphate. |
| Q: What is the InChIKey of tris(3,5,5-trimethylhexyl) phosphate? |
| A: InChIKey of tris(3,5,5-trimethylhexyl) phosphate is XJLVCRZMJZCMTG-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of tris(3,5,5-trimethylhexyl) phosphate? |
| A: Polar surface area (PSA) of tris(3,5,5-trimethylhexyl) phosphate is 54.57000. |
| Q: What is the molecular formula of tris(3,5,5-trimethylhexyl) phosphate? |
| A: Molecular formula of tris(3,5,5-trimethylhexyl) phosphate is C27H57O4P. |
| Q: What is the LogP of tris(3,5,5-trimethylhexyl) phosphate? |
| A: LogP of tris(3,5,5-trimethylhexyl) phosphate is 9.53150. |
| Q: What English synonyms does tris(3,5,5-trimethylhexyl) phosphate have? |
| A: English synonyms of tris(3,5,5-trimethylhexyl) phosphate: einecs 276-626-5. |
| Q: What is the Chinese name of 72386-53-9? |
| A: Chinese name of 72386-53-9 is 72386-53-9. |
| Q: What is the molecular weight of tris(3,5,5-trimethylhexyl) phosphate? |
| A: Molecular weight of tris(3,5,5-trimethylhexyl) phosphate is 476.71300. |
| Q: What is the CAS number of tris(3,5,5-trimethylhexyl) phosphate? |
| A: CAS number of tris(3,5,5-trimethylhexyl) phosphate is 72386-53-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |