5-Chloro-3-(4-chlorophenyl)-2,1-benzoxazole structure
|
Common Name | 5-Chloro-3-(4-chlorophenyl)-2,1-benzoxazole | ||
|---|---|---|---|---|
| CAS Number | 724-07-2 | Molecular Weight | 264.10700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-Chloro-3-(4-chlorophenyl)-2,1-benzoxazole |
|---|
| Molecular Formula | C13H7Cl2NO |
|---|---|
| Molecular Weight | 264.10700 |
| Exact Mass | 262.99000 |
| PSA | 26.03000 |
| LogP | 4.80160 |
| InChIKey | XCSDVPZODZDDPA-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2onc3ccc(Cl)cc23)cc1 |
| HS Code | 2934999090 |
|---|
|
~43%
5-Chloro-3-(4-c... CAS#:724-07-2 |
| Literature: Vejdelek; Polivka; Protiva Collection of Czechoslovak Chemical Communications, 1985 , vol. 50, # 5 p. 1064 - 1069 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Contractile Force Screening of ChemBridge Diverset library for asthma drug discovery
Source: 24015
Target: N/A
External Id: HSPH_Screening_CFS_002
|