6-but-3-enyl-1,3,5-triazine-2,4-diamine,ethyl prop-2-enoate,prop-2-enoic acid structure
|
Common Name | 6-but-3-enyl-1,3,5-triazine-2,4-diamine,ethyl prop-2-enoate,prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 72403-57-7 | Molecular Weight | 337.37400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-but-3-enyl-1,3,5-triazine-2,4-diamine,ethyl prop-2-enoate,prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H23N5O4 |
|---|---|
| Molecular Weight | 337.37400 |
| Exact Mass | 337.17500 |
| PSA | 155.77000 |
| LogP | 1.00730 |
| InChIKey | PFGYYJQHAZYEFD-UHFFFAOYSA-N |
| SMILES | C=CC(=O)O.C=CC(=O)OCC.C=CCCc1nc(N)nc(N)n1 |
| 2-Propenoic acid,polymer with 6-(3-butenyl)-1,3,5-triazine-2,4-diamine and ethyl 2-propenoate |
| Acrylic acid,ethyl acrylate,2,4-diamino-6-(3-butenyl)-s-triazine polymer |