bisphenol f bis(2,3-dihydroxypropyl) ether
Modify Date: 2025-08-22 11:38:41
bisphenol f bis(2,3-dihydroxypropyl) ether structure
|
Common Name | bisphenol f bis(2,3-dihydroxypropyl) ether | ||
|---|---|---|---|---|
| CAS Number | 72406-26-9 | Molecular Weight | 348.39000 | |
| Density | 1.273g/cm3 | Boiling Point | 612.8ºC at 760 mmHg | |
| Molecular Formula | C19H24O6 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 324.4ºC | |
| Name | 3-[4-[[4-(2,3-dihydroxypropoxy)phenyl]methyl]phenoxy]propane-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.273g/cm3 |
|---|---|
| Boiling Point | 612.8ºC at 760 mmHg |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.39000 |
| Flash Point | 324.4ºC |
| Exact Mass | 348.15700 |
| PSA | 99.38000 |
| LogP | 0.74140 |
| Index of Refraction | 1.599 |
| InChIKey | VGJRHUPDMVWBFM-UHFFFAOYSA-N |
| SMILES | OCC(O)COc1ccc(Cc2ccc(OCC(O)CO)cc2)cc1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| bfdge.2h2o |