sulphonylbis[tribromomethane] structure
|
Common Name | sulphonylbis[tribromomethane] | ||
|---|---|---|---|---|
| CAS Number | 7241-13-6 | Molecular Weight | 567.50900 | |
| Density | 3.508g/cm3 | Boiling Point | 176.9ºC at 760 mmHg | |
| Molecular Formula | C2Br6O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 60.8ºC | |
| Name | tribromo(tribromomethylsulfonyl)methane |
|---|---|
| Synonym | More Synonyms |
| Density | 3.508g/cm3 |
|---|---|
| Boiling Point | 176.9ºC at 760 mmHg |
| Molecular Formula | C2Br6O2S |
| Molecular Weight | 567.50900 |
| Flash Point | 60.8ºC |
| Exact Mass | 561.47200 |
| PSA | 42.52000 |
| LogP | 5.07400 |
| InChIKey | CNCAHWAKBQIUMY-UHFFFAOYSA-N |
| SMILES | O=S(=O)(C(Br)(Br)Br)C(Br)(Br)Br |
|
~%
sulphonylbis[tr... CAS#:7241-13-6 |
| Literature: Ilyushin, V. A. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1988 , vol. 37, p. 391 - 392 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1988 , # 2 p. 471 - 472 |
|
~%
sulphonylbis[tr... CAS#:7241-13-6 |
| Literature: Farrar Journal of the Chemical Society, 1956 , p. 508,510 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Hexabrom-dimethylsulfon |
| Bis-tribrommethyl-sulfon |
| EINECS 230-642-9 |
| hexabromodimethylsulfone |
| bis-tribromomethyl sulfone |
| Sulphonylbis(tribromomethane) |