2-[[(4-chlorophenyl)-phenylmethyl]amino]benzoic acid structure
|
Common Name | 2-[[(4-chlorophenyl)-phenylmethyl]amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 72417-82-4 | Molecular Weight | 337.80000 | |
| Density | 1.309g/cm3 | Boiling Point | 506.7ºC at 760 mmHg | |
| Molecular Formula | C20H16ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.2ºC | |
| Name | 2-[[(4-chlorophenyl)-phenylmethyl]amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.309g/cm3 |
|---|---|
| Boiling Point | 506.7ºC at 760 mmHg |
| Molecular Formula | C20H16ClNO2 |
| Molecular Weight | 337.80000 |
| Flash Point | 260.2ºC |
| Exact Mass | 337.08700 |
| PSA | 49.33000 |
| LogP | 5.31270 |
| Index of Refraction | 1.672 |
| InChIKey | QUTUJRKVWNTRPO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1NC(c1ccccc1)c1ccc(Cl)cc1 |
|
~88%
2-[[(4-chloroph... CAS#:72417-82-4 |
| Literature: Hikawa, Hidemasa; Suzuki, Hideharu; Yokoyama, Yuusaku; Azumaya, Isao Journal of Organic Chemistry, 2013 , vol. 78, # 13 p. 6714 - 6720 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-{[(4-chlorophenyl)(phenyl)methyl]amino}benzoic acid |
| 2-(4-Chlor-benzhydrylamino)-benzoesaeure |