(4-nitrophenyl) N,N-dimethylcarbamate structure
|
Common Name | (4-nitrophenyl) N,N-dimethylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 7244-70-4 | Molecular Weight | 210.18700 | |
| Density | 1.292g/cm3 | Boiling Point | 329.1ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.9ºC | |
| Name | (4-nitrophenyl) N,N-dimethylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 329.1ºC at 760 mmHg |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.18700 |
| Flash Point | 152.9ºC |
| Exact Mass | 210.06400 |
| PSA | 75.36000 |
| LogP | 2.17840 |
| Index of Refraction | 1.558 |
| InChIKey | YBRIFDNEMBTBMJ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2924299090 |
|---|
|
~80%
(4-nitrophenyl)... CAS#:7244-70-4 |
| Literature: John, Alex; Nicholas, Kenneth M. Journal of Organic Chemistry, 2012 , vol. 77, # 13 p. 5600 - 5605 |
|
~94%
(4-nitrophenyl)... CAS#:7244-70-4 |
| Literature: NEON LABORATORIES LTD.; DALVI, Mahesh Bhagoji; KENNY, Rajesh Shashikant; TARADE, Pradeep Kisan; CHINCHKAR, Dattatray Krishna Patent: WO2012/131699 A1, 2012 ; Location in patent: Page/Page column 11 ; |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N-dimethyl-carbamic acid 4-nitro-phenyl ester |
| Pnp dimethylcarbamate |
| N.N-Dimethyl-carbaminsaeure-<4-nitro-phenylester> |
| N.N-Dimethyl-carbamidsaeure-<4-nitro-phenylester> |
| Dimethyl-carbamidsaeure-(4-nitro-phenylester) |
| 4-Nitrophenyl dimethylcarbamate |
| p-nitrophenyl dimethylcarbamate |
| dimethyl-carbamic acid-(4-nitro-phenyl ester) |