bromo-tris(4-methylphenyl)germane structure
|
Common Name | bromo-tris(4-methylphenyl)germane | ||
|---|---|---|---|---|
| CAS Number | 72454-26-3 | Molecular Weight | 425.93500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21BrGe | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bromo-tris(4-methylphenyl)germane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H21BrGe |
|---|---|
| Molecular Weight | 425.93500 |
| Exact Mass | 426.00400 |
| LogP | 5.85040 |
| InChIKey | RLTVWVAZMUNXAV-UHFFFAOYSA-N |
| SMILES | Cc1ccc([Ge](Br)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
|
~%
bromo-tris(4-me... CAS#:72454-26-3 |
| Literature: Steliou, Kosta; Gareau, Yves; Harpp, David N. Journal of the American Chemical Society, 1984 , vol. 106, # 3 p. 799 - 801 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Germane,bromotris(4-methylphenyl) |
| [(p-tolyl)3(germanium)bromide] |
| tri(p-tolyl)bromogermane |
| Tri(p-tolyl)bromgerman |