Praeruptorin C structure
|
Common Name | Praeruptorin C | ||
|---|---|---|---|---|
| CAS Number | 72463-77-5 | Molecular Weight | 428.475 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 516.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H28O7 | Melting Point | 132-134ºC | |
| MSDS | N/A | Flash Point | 221.4±30.2 °C | |
Use of Praeruptorin CPraeruptorin C is a main bioactive constituent of Peucedanum praeruptorum (also known as Bai-Hua Qian Hu). Praeruptorin C is a calcium antagonist with pD2′ value of 5.7[1]. |
| Name | Praeruptorin E |
|---|---|
| Synonym | More Synonyms |
| Description | Praeruptorin C is a main bioactive constituent of Peucedanum praeruptorum (also known as Bai-Hua Qian Hu). Praeruptorin C is a calcium antagonist with pD2′ value of 5.7[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 516.5±50.0 °C at 760 mmHg |
| Melting Point | 132-134ºC |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.475 |
| Flash Point | 221.4±30.2 °C |
| Exact Mass | 428.183502 |
| PSA | 92.04000 |
| LogP | 5.59 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | UFUVJROSOIXJGR-IULGZIFLSA-N |
| SMILES | CC=C(C)C(=O)OC1C(OC(=O)CC(C)C)c2c(ccc3ccc(=O)oc23)OC1(C)C |
| Storage condition | 2-8C |
| (9S,10S)-8,8-Dimethyl-10-[(3-methylbutanoyl)oxy]-2-oxo-9,10-dihydro-2H,8H-pyrano[2,3-f]chromen-9-yl (2Z)-2-methyl-2-butenoate |
| (9S,10S)-8,8-Dimethyl-10-[(3-methylbutanoyl)oxy]-2-oxo-9,10-dihydro-2H,8H-pyrano[2,3-f]chromen-9-yl (2Z)-2-methylbut-2-enoate |
| Wulongensin A |