diethyl 2-[[4-[2-(2,4-diaminopteridin-6-yl)ethenyl]benzoyl]amino]pentanedioate structure
|
Common Name | diethyl 2-[[4-[2-(2,4-diaminopteridin-6-yl)ethenyl]benzoyl]amino]pentanedioate | ||
|---|---|---|---|---|
| CAS Number | 72469-06-8 | Molecular Weight | 493.51500 | |
| Density | 1.355g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H27N7O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-[[4-[(E)-2-(2,4-diaminopteridin-6-yl)ethenyl]benzoyl]amino]pentanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.355g/cm3 |
|---|---|
| Molecular Formula | C24H27N7O5 |
| Molecular Weight | 493.51500 |
| Exact Mass | 493.20700 |
| PSA | 185.30000 |
| LogP | 3.31270 |
| Index of Refraction | 1.673 |
| InChIKey | XEUPZCBKMDNZAG-JXMROGBWSA-N |
| SMILES | CCOC(=O)CCC(NC(=O)c1ccc(C=Cc2cnc3nc(N)nc(N)c3n2)cc1)C(=O)OCC |
|
~%
diethyl 2-[[4-[... CAS#:72469-06-8 |
| Literature: Piper, James R.; Montgomery, John A. Journal of Medicinal Chemistry, 1980 , vol. 23, # 3 p. 320 - 321 |
|
~%
diethyl 2-[[4-[... CAS#:72469-06-8 |
| Literature: Piper, James R.; Montgomery, John A. Journal of Medicinal Chemistry, 1980 , vol. 23, # 3 p. 320 - 321 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Diethyl dimethylphosphoramidate |
| diethyl N-{4-[2-(2,4-diamino-6-pteridinyl)vinyl]benzoyl}-L-glutamate |
| O,O-diethyl N,N-dimethylphosphoramide |
| diethyl N,N-dimethylphosphoramide |
| Diethyl dimethylamidophosphate |
| diethyl N,N-dimethyl-phosphoramidate |
| N,N-Dimethyl O,O'-diethyl phosphoramidate |
| NN-dimethyl diethyl-phosphoramidate |
| dimethyl-amidophosphoric acid diethyl ester |