9H-Purine,6-chloro-9-octyl- structure
|
Common Name | 9H-Purine,6-chloro-9-octyl- | ||
|---|---|---|---|---|
| CAS Number | 7247-96-3 | Molecular Weight | 266.77000 | |
| Density | 1.22g/cm3 | Boiling Point | 397.4ºC at 760 mmHg | |
| Molecular Formula | C13H19ClN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.2ºC | |
| Name | 6-chloro-9-octylpurine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 397.4ºC at 760 mmHg |
| Molecular Formula | C13H19ClN4 |
| Molecular Weight | 266.77000 |
| Flash Point | 194.2ºC |
| Exact Mass | 266.13000 |
| PSA | 43.60000 |
| LogP | 3.84020 |
| Index of Refraction | 1.602 |
| InChIKey | KIJQWBIFBRPOCT-UHFFFAOYSA-N |
| SMILES | CCCCCCCCn1cnc2c(Cl)ncnc21 |
|
~78%
9H-Purine,6-chl... CAS#:7247-96-3 |
| Literature: Bell, R. A.; Faggiani, R.; Hunter, H. N.; Lock, C. J. L. Canadian Journal of Chemistry, 1992 , vol. 70, p. 186 - 196 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 9-Octyl-6-chlor-9H-purin |
| 6-chloranyl-9-octyl-purine |
| 6-chloro-9-octyl-9h-purine |
| 9H-Purine,6-chloro-9-octyl |