4-(3',4'-dimethoxyphenyl)-3-acetyl-4-butanolide
Modify Date: 2025-09-23 11:52:01
4-(3',4'-dimethoxyphenyl)-3-acetyl-4-butanolide structure
|
Common Name | 4-(3',4'-dimethoxyphenyl)-3-acetyl-4-butanolide | ||
|---|---|---|---|---|
| CAS Number | 72471-47-7 | Molecular Weight | 264.27400 | |
| Density | 1.202g/cm3 | Boiling Point | 444.9ºC at 760 mmHg | |
| Molecular Formula | C14H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-acetyl-5-(3,4-dimethoxyphenyl)oxolan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.202g/cm3 |
|---|---|
| Boiling Point | 444.9ºC at 760 mmHg |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.27400 |
| Exact Mass | 264.10000 |
| PSA | 61.83000 |
| LogP | 1.89700 |
| Index of Refraction | 1.523 |
| InChIKey | UGADVQQKXGFQTG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2OC(=O)CC2C(C)=O)cc1OC |
|
~47%
4-(3',4'-dimeth... CAS#:72471-47-7 |
| Literature: Couquelet; Taoufik; et al. European Journal of Medicinal Chemistry, 1983 , vol. 18, # 4 p. 301 - 305 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2(3H)-Furanone,4,5-dihydro-4-acetyl-5-(3,4-dimethoxyphenyl)-,(E) |
| trans-4-Acetyl-5-(3,4-dimethoxyphenyl)-4,5-dihydro-2(3H)-furanone |
| 4-(3',4'-Dimethoxyphenyl)-3-acetyl-4-butanolide |