1-(methoxymethylselanyl)-3-(trifluoromethyl)benzene structure
|
Common Name | 1-(methoxymethylselanyl)-3-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 72474-63-6 | Molecular Weight | 269.12200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9F3OSe | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(methoxymethylselanyl)-3-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9F3OSe |
|---|---|
| Molecular Weight | 269.12200 |
| Exact Mass | 269.97700 |
| PSA | 9.23000 |
| LogP | 2.05710 |
| InChIKey | DBYAIHUJMTUBES-UHFFFAOYSA-N |
| SMILES | COC[Se]c1cccc(C(F)(F)F)c1 |
|
~%
1-(methoxymethy... CAS#:72474-63-6 |
| Literature: Reich,H.J. et al. Journal of the American Chemical Society, 1979 , vol. 101, p. 6638 - 6648 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Methoxymethyl(m-trifluoromethylphenyl)selenid |
| Benzene,1-[(methoxymethyl)seleno]-3-(trifluoromethyl) |