1-[2-(2,4-Dichlorophenyl)-2-[[4-(phenylthio)phenyl]methoxy]ethyl]-1H-imidazole structure
|
Common Name | 1-[2-(2,4-Dichlorophenyl)-2-[[4-(phenylthio)phenyl]methoxy]ethyl]-1H-imidazole | ||
|---|---|---|---|---|
| CAS Number | 72479-26-6 | Molecular Weight | 455.39900 | |
| Density | 1.26 g/cm3 | Boiling Point | 637.2ºC at 760 mmHg | |
| Molecular Formula | C24H20Cl2N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 339.2ºC | |
Use of 1-[2-(2,4-Dichlorophenyl)-2-[[4-(phenylthio)phenyl]methoxy]ethyl]-1H-imidazoleFenticonazole is an imidazole derivative with antibacterial and antifungal activity. Fenticonazole has the potential for the research of mixed vaginitis[1][2]. |
| Name | 1-[2-(2,4-dichlorophenyl)-2-[(4-phenylsulfanylphenyl)methoxy]ethyl]imidazole |
|---|---|
| Synonym | More Synonyms |
| Description | Fenticonazole is an imidazole derivative with antibacterial and antifungal activity. Fenticonazole has the potential for the research of mixed vaginitis[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.26 g/cm3 |
|---|---|
| Boiling Point | 637.2ºC at 760 mmHg |
| Molecular Formula | C24H20Cl2N2OS |
| Molecular Weight | 455.39900 |
| Flash Point | 339.2ºC |
| Exact Mass | 454.06700 |
| PSA | 52.35000 |
| LogP | 7.29920 |
| InChIKey | ZCJYUTQZBAIHBS-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C(Cn2ccnc2)OCc2ccc(Sc3ccccc3)cc2)c(Cl)c1 |
|
~%
1-[2-(2,4-Dichl... CAS#:72479-26-6 |
| Literature: Arzneimittel-Forschung/Drug Research, , vol. 31, # 12 p. 2123 - 2126 |
|
~%
1-[2-(2,4-Dichl... CAS#:72479-26-6 |
| Literature: Arzneimittel-Forschung/Drug Research, , vol. 31, # 12 p. 2123 - 2126 |
|
~%
1-[2-(2,4-Dichl... CAS#:72479-26-6 |
| Literature: Arzneimittel-Forschung/Drug Research, , vol. 31, # 12 p. 2123 - 2126 |
| Fenticonazole [INN:BAN] |
| Rec 15-1476 |
| FENTICONAZOLE |
| Fenticonazolum [INN-Latin] |
| Fenticonazol [INN-Spanish] |
| 1-[2-(2,4-dichloro-phenyl)-2-(4-phenylsulfanyl-benzyloxy)-ethyl]-1H-imidazole |
| Fenticonazolum |
| 1H-Imidazole,1-(2-(2,4-dichlorophenyl)-2-((4-(phenylthio)phenyl)methoxy)ethyl) |
| MFCD00865611 |
| Fenticonazol |
| 1-[2-(2,4-Dichlorophenyl)-2-[[4-(phenylthio)phenyl]methoxy]ethyl]-1H-imidazole |