1-(9H-carbazol-3-yl)ethanol structure
|
Common Name | 1-(9H-carbazol-3-yl)ethanol | ||
|---|---|---|---|---|
| CAS Number | 7248-79-5 | Molecular Weight | 211.25900 | |
| Density | 1.264g/cm3 | Boiling Point | 435ºC at 760 mmHg | |
| Molecular Formula | C14H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.9ºC | |
| Name | 1-(9H-carbazol-3-yl)ethanol |
|---|
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 435ºC at 760 mmHg |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.25900 |
| Flash Point | 216.9ºC |
| Exact Mass | 211.10000 |
| PSA | 36.02000 |
| LogP | 3.37440 |
| Index of Refraction | 1.741 |
| InChIKey | IAIXICCLJFCZCJ-UHFFFAOYSA-N |
| SMILES | CC(O)c1ccc2[nH]c3ccccc3c2c1 |
|
~85%
1-(9H-carbazol-... CAS#:7248-79-5 |
| Literature: Hu, Qingzhong; Negri, Matthias; Jahn-Hoffmann, Kerstin; Zhuang, Yan; Olgen, Sureyya; Bartels, Marc; Mueller-Vieira, Ursula; Lauterbach, Thomas; Hartmann, Rolf W. Bioorganic and Medicinal Chemistry, 2008 , vol. 16, # 16 p. 7715 - 7727 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |