piperidine-1-carbothioyl piperidine-1-carbodithioate structure
|
Common Name | piperidine-1-carbothioyl piperidine-1-carbodithioate | ||
|---|---|---|---|---|
| CAS Number | 725-32-6 | Molecular Weight | 288.49600 | |
| Density | 1.278g/cm3 | Boiling Point | 397.7ºC at 760 mmHg | |
| Molecular Formula | C12H20N2S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.3ºC | |
| Name | piperidine-1-carbothioyl piperidine-1-carbodithioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.278g/cm3 |
|---|---|
| Boiling Point | 397.7ºC at 760 mmHg |
| Molecular Formula | C12H20N2S3 |
| Molecular Weight | 288.49600 |
| Flash Point | 194.3ºC |
| Exact Mass | 288.07900 |
| PSA | 95.96000 |
| LogP | 3.13700 |
| Index of Refraction | 1.655 |
| InChIKey | PFOWLPUJPOQMAL-UHFFFAOYSA-N |
| SMILES | S=C(SC(=S)N1CCCCC1)N1CCCCC1 |
|
~%
piperidine-1-ca... CAS#:725-32-6 |
| Literature: D'Amico, John J.; Bollinger, Frederic G.; Tung, Ching C.; Dahl, William E. Journal of Heterocyclic Chemistry, 1987 , vol. 24, p. 945 - 948 |
|
~%
piperidine-1-ca... CAS#:725-32-6 |
| Literature: D'Amico, John J.; Bollinger, Frederic G.; Tung, Ching C.; Dahl, William E. Journal of Heterocyclic Chemistry, 1987 , vol. 24, p. 945 - 948 |
|
~%
piperidine-1-ca... CAS#:725-32-6 |
| Literature: Kloepping; van der Kerk Recueil des Travaux Chimiques des Pays-Bas, 1951 , vol. 70, p. 917,935 |
|
~%
piperidine-1-ca... CAS#:725-32-6 |
| Literature: Sharples Chem. Inc. Patent: US2524081 , 1948 ; |
| Piperidine-1-dithiocarboxylic acid,anhydrosulphide |
| bis(1-piperidinylthiocarbonyl)sulfide |
| Dipentamethylenethiuram monosulfide |
| N,N,N',N'-Bis(pentamethylen)thiurainsulfid |
| anhydrosulfide |
| Dicyclopentamethylenthiurammonosulfid |
| bis-(piperidine-1-carbothioic acid )-thioanhydride |
| Bis-(piperidin-1-thiocarbonsaeure)-thioanhydrid |
| piperidine-1-dithiocarboxylic acid |
| 1-Piperidinecarbodithioic acid,anhydrosulfide |
| bis(N,N-pentamethylene thiocarbamoyl) sulphide |