2-(5-bromopyridin-1-yl)-1-(2,5-dichlorophenyl)ethanone structure
|
Common Name | 2-(5-bromopyridin-1-yl)-1-(2,5-dichlorophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 7250-05-7 | Molecular Weight | 425.93100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9Br2Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-bromopyridin-1-ium-1-yl)-1-(2,5-dichlorophenyl)ethanone,bromide |
|---|
| Molecular Formula | C13H9Br2Cl2NO |
|---|---|
| Molecular Weight | 425.93100 |
| Exact Mass | 422.84300 |
| PSA | 20.95000 |
| LogP | 0.93030 |
| InChIKey | LBTLUENWGULLDB-UHFFFAOYSA-M |
| SMILES | O=C(C[n+]1cccc(Br)c1)c1cc(Cl)ccc1Cl.[Br-] |
|
~%
2-(5-bromopyrid... CAS#:7250-05-7 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3499 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |