1-(4-methylsulfanylphenyl)-2-pyridin-1-yl-ethanone structure
|
Common Name | 1-(4-methylsulfanylphenyl)-2-pyridin-1-yl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 7250-10-4 | Molecular Weight | 371.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14INOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methylsulfanylphenyl)-2-pyridin-1-ium-1-ylethanone,iodide |
|---|
| Molecular Formula | C14H14INOS |
|---|---|
| Molecular Weight | 371.23700 |
| Exact Mass | 370.98400 |
| PSA | 46.25000 |
| InChIKey | DDIGNDOKILQRIP-UHFFFAOYSA-M |
| SMILES | CSc1ccc(C(=O)C[n+]2ccccc2)cc1.[I-] |
|
~%
1-(4-methylsulf... CAS#:7250-10-4 |
| Literature: Ganapathy, K.; Ramanujam, M. Journal of the Indian Chemical Society, 1981 , vol. 58, p. 701 - 703 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |