9,11-methane-epoxy Prostaglandin F1α structure
|
Common Name | 9,11-methane-epoxy Prostaglandin F1α | ||
|---|---|---|---|---|
| CAS Number | 72517-81-8 | Molecular Weight | 352.508 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 519.1±25.0 °C at 760 mmHg | |
| Molecular Formula | C21H36O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.9±16.7 °C | |
| Name | 9,11-methane-epoxy Prostaglandin F1.α. |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 519.1±25.0 °C at 760 mmHg |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.508 |
| Flash Point | 174.9±16.7 °C |
| Exact Mass | 352.261353 |
| PSA | 66.76000 |
| LogP | 4.31 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | VGRVXLWYKKBTNM-XLGWHITOSA-N |
| SMILES | CCCCCC(O)C=CC1C2CC(CO2)C1CCCCCCC(=O)O |
|
~%
9,11-methane-ep... CAS#:72517-81-8 |
| Literature: Sakai; Inoue; Amemiya; Morita; Kojima Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 6 p. 1814 - 1819 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 7-{(1S,4R,5S,6R)-6-[(1E,3S)-3-Hydroxy-1-octen-1-yl]-2-oxabicyclo[2.2.1]hept-5-yl}heptanoic acid |
| 2-Oxabicyclo[2.2.1]heptane-5-heptanoic acid, 6-[(1E,3S)-3-hydroxy-1-octen-1-yl]-, (1R,4S,5S,6R)- |
| Acyclic Th analog |
| 2-Oxabicyclo[2.2.1]heptane-5-heptanoic acid, 6-[(1E,3S)-3-hydroxy-1-octen-1-yl]-, (1S,4R,5S,6R)- |
| 7-{(1R,4S,5S,6R)-6-[(1E,3S)-3-Hydroxy-1-octen-1-yl]-2-oxabicyclo[2.2.1]hept-5-yl}heptanoic acid |