Phenol,2-methoxy-4-[1-(phenylsulfonyl)ethyl]- structure
|
Common Name | Phenol,2-methoxy-4-[1-(phenylsulfonyl)ethyl]- | ||
|---|---|---|---|---|
| CAS Number | 7252-28-0 | Molecular Weight | 292.35000 | |
| Density | 1.262g/cm3 | Boiling Point | 496.4ºC at 760mmHg | |
| Molecular Formula | C15H16O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254ºC | |
| Name | 4-[1-(benzenesulfonyl)ethyl]-2-methoxyphenol |
|---|
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 496.4ºC at 760mmHg |
| Molecular Formula | C15H16O4S |
| Molecular Weight | 292.35000 |
| Flash Point | 254ºC |
| Exact Mass | 292.07700 |
| PSA | 71.98000 |
| LogP | 4.01650 |
| Index of Refraction | 1.583 |
| InChIKey | QWABOYGSLRBKPS-UHFFFAOYSA-N |
| SMILES | COc1cc(C(C)S(=O)(=O)c2ccccc2)ccc1O |
|
~%
Phenol,2-methox... CAS#:7252-28-0 |
| Literature: Pavlickova,L. et al. Collection of Czechoslovak Chemical Communications, 1976 , vol. 41, p. 299 - 310 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |