4-[(4-chlorophenyl)hydrazinylidene]naphthalen-1-one structure
|
Common Name | 4-[(4-chlorophenyl)hydrazinylidene]naphthalen-1-one | ||
|---|---|---|---|---|
| CAS Number | 7252-64-4 | Molecular Weight | 282.72400 | |
| Density | 1.28g/cm3 | Boiling Point | 431.3ºC at 760 mmHg | |
| Molecular Formula | C16H11ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.6ºC | |
| Name | (4E)-4-[(4-chlorophenyl)hydrazinylidene]naphthalen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 431.3ºC at 760 mmHg |
| Molecular Formula | C16H11ClN2O |
| Molecular Weight | 282.72400 |
| Flash Point | 214.6ºC |
| Exact Mass | 282.05600 |
| PSA | 44.95000 |
| LogP | 5.61420 |
| Index of Refraction | 1.647 |
| InChIKey | GJXLPATZJPHDGX-UHFFFAOYSA-N |
| SMILES | Oc1ccc(N=Nc2ccc(Cl)cc2)c2ccccc12 |
|
~%
4-[(4-chlorophe... CAS#:7252-64-4 |
| Literature: Li, Guang-Lei; Ye, Hui; Chen, Yu; Zhao, Bao-Dong; Wang, Tao Inorganic Chemistry Communications, 2011 , vol. 14, # 9 p. 1516 - 1519 |
|
~%
4-[(4-chlorophe... CAS#:7252-64-4 |
| Literature: Shingu Scientific Papers of the Institute of Physical and Chemical Research (Japan), 1938 , vol. 35, p. 78,105, 110 |
| 4-Chlorbenzol-(1-azo-4)-naphthol-1 |
| 4-hydroxynaphthyl azo-4'-chlorobenzene |
| 4-(4-chloro-phenylazo)-[1]naphthol |
| 4-(4'-Chlor-phenylazo)-<1>naphthol |
| naphthoquinone 1-[(4-chlorophenyl)hydrazone] |
| 4-[(E)-(4-Chlorophenyl)diazenyl]-1-naphthol |
| 4-<4-Chlor-benzolazo>-naphthol-(1) |
| 1-Naphthalenol,4-[(4-chlorophenyl)azo] |