1-(5-bromo-2-hydroxy-6-methoxy-3-nitro-phenyl)ethanone structure
|
Common Name | 1-(5-bromo-2-hydroxy-6-methoxy-3-nitro-phenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 7253-20-5 | Molecular Weight | 290.06800 | |
| Density | 1.692g/cm3 | Boiling Point | 332.5ºC at 760 mmHg | |
| Molecular Formula | C9H8BrNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.9ºC | |
| Name | 1-(5-bromo-2-hydroxy-6-methoxy-3-nitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.692g/cm3 |
|---|---|
| Boiling Point | 332.5ºC at 760 mmHg |
| Molecular Formula | C9H8BrNO5 |
| Molecular Weight | 290.06800 |
| Flash Point | 154.9ºC |
| Exact Mass | 288.95900 |
| PSA | 92.35000 |
| LogP | 2.79730 |
| Index of Refraction | 1.605 |
| InChIKey | FSDPWNYTSUICQP-UHFFFAOYSA-N |
| SMILES | COc1c(Br)cc([N+](=O)[O-])c(O)c1C(C)=O |
|
~%
1-(5-bromo-2-hy... CAS#:7253-20-5 |
| Literature: Krause,G.H.; Hoyer,H. Zeitschrift fuer Naturforschung, Teil B: Anorganische Chemie, Organische Chemie, Biochemie, Biophysik, Biologie, 1972 , vol. 27, p. 663 - 674 |
|
~%
1-(5-bromo-2-hy... CAS#:7253-20-5 |
| Literature: Dalvi; Jadhav Journal of the Indian Chemical Society, 1957 , vol. 34, p. 324 |
|
~%
1-(5-bromo-2-hy... CAS#:7253-20-5 |
| Literature: Dalvi; Jadhav Journal of the Indian Chemical Society, 1957 , vol. 34, p. 324 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Brom-2-hydroxy-6-methoxy-3-nitro-acetophenon |