[[2-(N-benzoyloxycarbamimidoyl)-3-methyl-pentanoyl]amino] benzoate
![[[2-(N-benzoyloxycarbamimidoyl)-3-methyl-pentanoyl]amino] benzoate Structure](https://image.chemsrc.com/caspic/430/7253-29-4.png)
[[2-(N-benzoyloxycarbamimidoyl)-3-methyl-pentanoyl]amino] benzoate structure
|
Common Name | [[2-(N-benzoyloxycarbamimidoyl)-3-methyl-pentanoyl]amino] benzoate | ||
|---|---|---|---|---|
| CAS Number | 7253-29-4 | Molecular Weight | 397.42400 | |
| Density | 1.23g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H23N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.23g/cm3 |
|---|---|
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.42400 |
| Exact Mass | 397.16400 |
| PSA | 117.58000 |
| LogP | 3.75730 |
| Index of Refraction | 1.578 |
| InChIKey | AXYSCPDLUFUEAB-UHFFFAOYSA-N |
| SMILES | CCC(C)C(C(=O)NOC(=O)c1ccccc1)C(N)=NOC(=O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
[[2-(N-benzoylo... CAS#:7253-29-4 |
| Literature: Bauer,L.; Nambury,C.N.V. Journal of Organic Chemistry, 1961 , vol. 26, p. 4917 - 4922 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 7253-29-4? |
| A: Chinese name of 7253-29-4 is 7253-29-4. |
| Q: What is the polar surface area (PSA) of sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat? |
| A: Polar surface area (PSA) of sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat is 117.58000. |
| Q: What is the English name of sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat? |
| A: The English name of sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat is sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat. |
| Q: What is the CAS number of sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat? |
| A: CAS number of sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat is 7253-29-4. |
| Q: What is the InChIKey of sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat? |
| A: InChIKey of sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat is AXYSCPDLUFUEAB-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat? |
| A: SMILES notation of sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat is CCC(C)C(C(=O)NOC(=O)c1ccccc1)C(N)=NOC(=O)c1ccccc1. |
| Q: What are the upstream materials of sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat? |
| A: Related upstream materials(CAS) of sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat: 7309-45-7;98-88-4. |
| Q: What is the LogP of sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat? |
| A: LogP of sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat is 3.75730. |
| Q: What is the molecular formula of sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat? |
| A: Molecular formula of sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat is C21H23N3O5. |
| Q: What is the molecular weight of sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat? |
| A: Molecular weight of sek. Butyl-malon-amidoxim-hydroxamsaeure-dibenzoat is 397.42400. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |