1,12-dibromododecane-2,11-dione
1,12-dibromododecane-2,11-dione structure
|
Common Name | 1,12-dibromododecane-2,11-dione | ||
|---|---|---|---|---|
| CAS Number | 7253-38-5 | Molecular Weight | 356.09400 | |
| Density | 1.44g/cm3 | Boiling Point | 428ºC at 760 mmHg | |
| Molecular Formula | C12H20Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,12-dibromododecane-2,11-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 428ºC at 760 mmHg |
| Molecular Formula | C12H20Br2O2 |
| Molecular Weight | 356.09400 |
| Flash Point | 108ºC |
| Exact Mass | 353.98300 |
| PSA | 34.14000 |
| LogP | 4.03520 |
| Index of Refraction | 1.503 |
| InChIKey | JBSNFHDKPPFBGK-UHFFFAOYSA-N |
| SMILES | O=C(CBr)CCCCCCCCC(=O)CBr |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,12-dibromodod... CAS#:7253-38-5 |
| Literature: Wilson; Lutz; Jordan Journal of Organic Chemistry, 1947 , vol. 12, p. 778 |
|
~%
1,12-dibromodod... CAS#:7253-38-5 |
| Literature: Fahr,E. Justus Liebigs Annalen der Chemie, 1960 , vol. 638, p. 1 - 32 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 3 | |
![1-[14-(3,5-dimethoxyphenyl)tetradecyl]-3,5-dimethoxybenzene structure](https://image.chemsrc.com/caspic/472/21390-07-8.png)
CAS#:21390-07-8
CAS#:7512-32-5
CAS#:6282-21-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,12-Dibrom-dodecan-2,11-dion |
| 1,12-dibromo-dodecane-2,11-dione |
| 1,12-Dibromododecan-2,11-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1,12-dibromododecane-2,11-dione? |
| A: SMILES notation of 1,12-dibromododecane-2,11-dione is O=C(CBr)CCCCCCCCC(=O)CBr. |
| Q: What is the LogP of 1,12-dibromododecane-2,11-dione? |
| A: LogP of 1,12-dibromododecane-2,11-dione is 4.03520. |
| Q: What is the Chinese name of 7253-38-5? |
| A: Chinese name of 7253-38-5 is 7253-38-5. |
| Q: What is the boiling point of 1,12-dibromododecane-2,11-dione? |
| A: Boiling point of 1,12-dibromododecane-2,11-dione is 428ºC at 760 mmHg. |
| Q: What is the molecular formula of 1,12-dibromododecane-2,11-dione? |
| A: Molecular formula of 1,12-dibromododecane-2,11-dione is C12H20Br2O2. |
| Q: What is the InChIKey of 1,12-dibromododecane-2,11-dione? |
| A: InChIKey of 1,12-dibromododecane-2,11-dione is JBSNFHDKPPFBGK-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 1,12-dibromododecane-2,11-dione? |
| A: Related upstream materials(CAS) of 1,12-dibromododecane-2,11-dione: 55349-59-2;111-19-3. |
| Q: What is the molecular weight of 1,12-dibromododecane-2,11-dione? |
| A: Molecular weight of 1,12-dibromododecane-2,11-dione is 356.09400. |
| Q: What is the English name of 1,12-dibromododecane-2,11-dione? |
| A: The English name of 1,12-dibromododecane-2,11-dione is 1,12-dibromododecane-2,11-dione. |
| Q: What English synonyms does 1,12-dibromododecane-2,11-dione have? |
| A: English synonyms of 1,12-dibromododecane-2,11-dione: 1,12-Dibrom-dodecan-2,11-dion, 1,12-dibromo-dodecane-2,11-dione, 1,12-Dibromododecan-2,11-dione. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |