2-methyl-2-[2-(1-methyl-3,4,5,6-tetrahydro-2H-pyridin-1-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole structure
|
Common Name | 2-methyl-2-[2-(1-methyl-3,4,5,6-tetrahydro-2H-pyridin-1-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole | ||
|---|---|---|---|---|
| CAS Number | 7253-51-2 | Molecular Weight | 393.37000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H34IN2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-2-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-ium,iodide |
|---|
| Molecular Formula | C17H34IN2+ |
|---|---|
| Molecular Weight | 393.37000 |
| Exact Mass | 393.17700 |
| InChIKey | ALRRNJOXXXNHMQ-UHFFFAOYSA-M |
| SMILES | C[N+]1(CC[N+]2(C)CC3CCCCC3C2)CCCCC1.[I-] |
|
~%
2-methyl-2-[2-(... CAS#:7253-51-2 |
| Literature: Rice et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 4911,4914 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|