(2-acetyloxy-3-acetylsulfanyl-propyl) acetate
(2-acetyloxy-3-acetylsulfanyl-propyl) acetate structure
|
Common Name | (2-acetyloxy-3-acetylsulfanyl-propyl) acetate | ||
|---|---|---|---|---|
| CAS Number | 7253-53-4 | Molecular Weight | 234.26900 | |
| Density | 1.198g/cm3 | Boiling Point | 315.9ºC at 760 mmHg | |
| Molecular Formula | C9H14O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-diacetoxy-3-acetylsulfanyl-propane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.198g/cm3 |
|---|---|
| Boiling Point | 315.9ºC at 760 mmHg |
| Molecular Formula | C9H14O5S |
| Molecular Weight | 234.26900 |
| Flash Point | 144.5ºC |
| Exact Mass | 234.05600 |
| PSA | 94.97000 |
| LogP | 0.76090 |
| Index of Refraction | 1.477 |
| InChIKey | AYIPZDFBNMDHIZ-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(CSC(C)=O)OC(C)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(2-acetyloxy-3-... CAS#:7253-53-4 |
| Literature: Sjoeberg Chemische Berichte, 1942 , vol. 75, p. 24 |
|
~%
(2-acetyloxy-3-... CAS#:7253-53-4 |
| Literature: Horton,D.; Wolfrom,M.L. Journal of Organic Chemistry, 1962 , vol. 27, p. 1794 - 1800 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2-Di-O-acetyl-3-S-acetyl-3-thio-glycerin |
| 1,2-Diacetoxy-3-acetylmercapto-propan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,2-diacetoxy-3-acetylsulfanyl-propane? |
| A: Molecular weight of 1,2-diacetoxy-3-acetylsulfanyl-propane is 234.26900. |
| Q: What is the English name of 1,2-diacetoxy-3-acetylsulfanyl-propane? |
| A: The English name of 1,2-diacetoxy-3-acetylsulfanyl-propane is 1,2-diacetoxy-3-acetylsulfanyl-propane. |
| Q: What English synonyms does 1,2-diacetoxy-3-acetylsulfanyl-propane have? |
| A: English synonyms of 1,2-diacetoxy-3-acetylsulfanyl-propane: 1,2-Di-O-acetyl-3-S-acetyl-3-thio-glycerin, 1,2-Diacetoxy-3-acetylmercapto-propan. |
| Q: What is the InChIKey of 1,2-diacetoxy-3-acetylsulfanyl-propane? |
| A: InChIKey of 1,2-diacetoxy-3-acetylsulfanyl-propane is AYIPZDFBNMDHIZ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,2-diacetoxy-3-acetylsulfanyl-propane? |
| A: CAS number of 1,2-diacetoxy-3-acetylsulfanyl-propane is 7253-53-4. |
| Q: What is the molecular formula of 1,2-diacetoxy-3-acetylsulfanyl-propane? |
| A: Molecular formula of 1,2-diacetoxy-3-acetylsulfanyl-propane is C9H14O5S. |
| Q: What is the boiling point of 1,2-diacetoxy-3-acetylsulfanyl-propane? |
| A: Boiling point of 1,2-diacetoxy-3-acetylsulfanyl-propane is 315.9ºC at 760 mmHg. |
| Q: What are the upstream materials of 1,2-diacetoxy-3-acetylsulfanyl-propane? |
| A: Related upstream materials(CAS) of 1,2-diacetoxy-3-acetylsulfanyl-propane: 507-09-5;96-27-5;108-24-7. |
| Q: What is the polar surface area (PSA) of 1,2-diacetoxy-3-acetylsulfanyl-propane? |
| A: Polar surface area (PSA) of 1,2-diacetoxy-3-acetylsulfanyl-propane is 94.97000. |
| Q: What is the SMILES notation of 1,2-diacetoxy-3-acetylsulfanyl-propane? |
| A: SMILES notation of 1,2-diacetoxy-3-acetylsulfanyl-propane is CC(=O)OCC(CSC(C)=O)OC(C)=O. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |