(2-acetyloxy-3-acetylsulfanyl-propyl) acetate
Modify Date: 2025-08-25 13:01:57
(2-acetyloxy-3-acetylsulfanyl-propyl) acetate structure
|
Common Name | (2-acetyloxy-3-acetylsulfanyl-propyl) acetate | ||
|---|---|---|---|---|
| CAS Number | 7253-53-4 | Molecular Weight | 234.26900 | |
| Density | 1.198g/cm3 | Boiling Point | 315.9ºC at 760 mmHg | |
| Molecular Formula | C9H14O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.5ºC | |
| Name | 1,2-diacetoxy-3-acetylsulfanyl-propane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.198g/cm3 |
|---|---|
| Boiling Point | 315.9ºC at 760 mmHg |
| Molecular Formula | C9H14O5S |
| Molecular Weight | 234.26900 |
| Flash Point | 144.5ºC |
| Exact Mass | 234.05600 |
| PSA | 94.97000 |
| LogP | 0.76090 |
| Index of Refraction | 1.477 |
| InChIKey | AYIPZDFBNMDHIZ-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(CSC(C)=O)OC(C)=O |
|
~%
(2-acetyloxy-3-... CAS#:7253-53-4 |
| Literature: Sjoeberg Chemische Berichte, 1942 , vol. 75, p. 24 |
|
~%
(2-acetyloxy-3-... CAS#:7253-53-4 |
| Literature: Horton,D.; Wolfrom,M.L. Journal of Organic Chemistry, 1962 , vol. 27, p. 1794 - 1800 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,2-Di-O-acetyl-3-S-acetyl-3-thio-glycerin |
| 1,2-Diacetoxy-3-acetylmercapto-propan |