2-Phenyl-2-(1-piperidinyl)acetamide
Modify Date: 2025-09-18 12:36:38
2-Phenyl-2-(1-piperidinyl)acetamide structure
|
Common Name | 2-Phenyl-2-(1-piperidinyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 7253-67-0 | Molecular Weight | 218.29500 | |
| Density | 1.125g/cm3 | Boiling Point | 361.4ºC at 760 mmHg | |
| Molecular Formula | C13H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.4ºC | |
| Name | 2-phenyl-2-piperidin-1-ylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.125g/cm3 |
|---|---|
| Boiling Point | 361.4ºC at 760 mmHg |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.29500 |
| Flash Point | 172.4ºC |
| Exact Mass | 218.14200 |
| PSA | 46.33000 |
| LogP | 2.33710 |
| Index of Refraction | 1.574 |
| InChIKey | PPRXELUQRNIPDC-UHFFFAOYSA-N |
| SMILES | NC(=O)C(c1ccccc1)N1CCCCC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-phenyl-2-piperidin-1-yl-acetamide |
| phenyl-piperidino-acetic acid amide |
| 2-phenyl-2-piperidinoacetamide |
| Phenyl-piperidino-essigsaeure-amid |
| 2-Phenyl-2-piperidinacetamid |