ethyl 4-(methylcarbamoylamino)benzoate
ethyl 4-(methylcarbamoylamino)benzoate structure
|
Common Name | ethyl 4-(methylcarbamoylamino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 7253-98-7 | Molecular Weight | 222.24000 | |
| Density | 1.196g/cm3 | Boiling Point | 332.2ºC at 760 mmHg | |
| Molecular Formula | C11H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 4-(methylcarbamoylamino)benzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 332.2ºC at 760 mmHg |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24000 |
| Flash Point | 154.7ºC |
| Exact Mass | 222.10000 |
| PSA | 67.43000 |
| LogP | 2.07850 |
| Index of Refraction | 1.565 |
| InChIKey | RDKOZKWHANEUNF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(NC(=O)NC)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ethyl 4-(methyl... CAS#:7253-98-7 |
| Literature: Johnston,T.P. et al. J. Med. Chem., 1963 , vol. 6, p. 669 - 681 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![Benzoic acid,4-[[(methylnitrosoamino)carbonyl]amino]-, ethyl ester structure](https://image.chemsrc.com/caspic/053/91332-70-6.png)
CAS#:91332-70-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-Methyl-N'-<4-ethoxycarbonyl-phenyl>-harnstoff |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of ethyl 4-(methylcarbamoylamino)benzoate? |
| A: Related upstream materials(CAS) of ethyl 4-(methylcarbamoylamino)benzoate: 624-83-9;94-09-7. |
| Q: What is the LogP of ethyl 4-(methylcarbamoylamino)benzoate? |
| A: LogP of ethyl 4-(methylcarbamoylamino)benzoate is 2.07850. |
| Q: What is the boiling point of ethyl 4-(methylcarbamoylamino)benzoate? |
| A: Boiling point of ethyl 4-(methylcarbamoylamino)benzoate is 332.2ºC at 760 mmHg. |
| Q: What is the molecular formula of ethyl 4-(methylcarbamoylamino)benzoate? |
| A: Molecular formula of ethyl 4-(methylcarbamoylamino)benzoate is C11H14N2O3. |
| Q: What is the InChIKey of ethyl 4-(methylcarbamoylamino)benzoate? |
| A: InChIKey of ethyl 4-(methylcarbamoylamino)benzoate is RDKOZKWHANEUNF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of ethyl 4-(methylcarbamoylamino)benzoate? |
| A: SMILES notation of ethyl 4-(methylcarbamoylamino)benzoate is CCOC(=O)c1ccc(NC(=O)NC)cc1. |
| Q: What is the CAS number of ethyl 4-(methylcarbamoylamino)benzoate? |
| A: CAS number of ethyl 4-(methylcarbamoylamino)benzoate is 7253-98-7. |
| Q: What is the polar surface area (PSA) of ethyl 4-(methylcarbamoylamino)benzoate? |
| A: Polar surface area (PSA) of ethyl 4-(methylcarbamoylamino)benzoate is 67.43000. |
| Q: What is the Chinese name of 7253-98-7? |
| A: Chinese name of 7253-98-7 is 7253-98-7. |
| Q: What is the English name of ethyl 4-(methylcarbamoylamino)benzoate? |
| A: The English name of ethyl 4-(methylcarbamoylamino)benzoate is ethyl 4-(methylcarbamoylamino)benzoate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |