1,3-dimethyl-6-(4-methylanilino)pyrimidine-2,4-dione structure
|
Common Name | 1,3-dimethyl-6-(4-methylanilino)pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 7256-86-2 | Molecular Weight | 245.27700 | |
| Density | 1.263g/cm3 | Boiling Point | 367.5ºC at 760 mmHg | |
| Molecular Formula | C13H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176ºC | |
| Name | 1,3-dimethyl-6-(4-methylanilino)pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.263g/cm3 |
|---|---|
| Boiling Point | 367.5ºC at 760 mmHg |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.27700 |
| Flash Point | 176ºC |
| Exact Mass | 245.11600 |
| PSA | 56.03000 |
| LogP | 1.20900 |
| Index of Refraction | 1.628 |
| InChIKey | ZAXVAVJUYTUDSX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2cc(=O)n(C)c(=O)n2C)cc1 |
|
~82%
1,3-dimethyl-6-... CAS#:7256-86-2 |
| Literature: Krasnov Russian Journal of Organic Chemistry, 1998 , vol. 34, # 1 p. 115 - 119 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3-Dimethyl-6-(4-methyl-anilin)-uracil |
| 1,3-dimethyl-6-(4-methyl-anilino)-1H-pyrimidine-2,4-dione |
| 1,3-dimethyl-4-(4-methylphenylamino)pyrimidine-2,6(1H,3H)-dione |
| 1,3-Dimethyl-6-p-tolylaminouracil |
| 1,3-Dimethyl-6-(p-toluidino)uracil |
| 1,3-Dimethyl-6-p-tolylamino-1H-pyrimidine-2,4-dione |
| 1,3-Dimethyl-4-<p-toluidino>-uracil |