1-Nonen-3-one,1-(3-hydroxyphenyl)-, (E)- (9CI) structure
|
Common Name | 1-Nonen-3-one,1-(3-hydroxyphenyl)-, (E)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 72570-84-4 | Molecular Weight | 232.31800 | |
| Density | 1.032g/cm3 | Boiling Point | 398.8ºC at 760mmHg | |
| Molecular Formula | C15H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.3ºC | |
| Name | (E)-1-(3-hydroxyphenyl)non-1-en-3-one |
|---|
| Density | 1.032g/cm3 |
|---|---|
| Boiling Point | 398.8ºC at 760mmHg |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.31800 |
| Flash Point | 170.3ºC |
| Exact Mass | 232.14600 |
| PSA | 37.30000 |
| LogP | 3.94490 |
| Index of Refraction | 1.551 |
| InChIKey | VHDCFLKVSUAWNU-ZHACJKMWSA-N |
| SMILES | CCCCCCC(=O)C=Cc1cccc(O)c1 |
|
~%
1-Nonen-3-one,1... CAS#:72570-84-4 |
| Literature: Dimmock; Nyathi; Smith Journal of Pharmaceutical Sciences, 1979 , vol. 68, # 10 p. 1216 - 1221 |
|
~%
1-Nonen-3-one,1... CAS#:72570-84-4 |
| Literature: Dimmock; Nyathi; Smith Journal of Pharmaceutical Sciences, 1979 , vol. 68, # 10 p. 1216 - 1221 |
|
~%
1-Nonen-3-one,1... CAS#:72570-84-4 |
| Literature: Dimmock; Nyathi; Smith Journal of Pharmaceutical Sciences, 1979 , vol. 68, # 10 p. 1216 - 1221 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |