2-amino-1-(4-methoxyphenyl)-4,5-dimethylpyrrole-3-carbonitrile structure
|
Common Name | 2-amino-1-(4-methoxyphenyl)-4,5-dimethylpyrrole-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 72578-38-2 | Molecular Weight | 241.28800 | |
| Density | 1.15g/cm3 | Boiling Point | 457.6ºC at 760 mmHg | |
| Molecular Formula | C14H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.6ºC | |
| Name | 2-amino-1-(4-methoxyphenyl)-4,5-dimethylpyrrole-3-carbonitrile |
|---|
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 457.6ºC at 760 mmHg |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.28800 |
| Flash Point | 230.6ºC |
| Exact Mass | 241.12200 |
| PSA | 63.97000 |
| LogP | 3.13778 |
| Index of Refraction | 1.589 |
| InChIKey | MLNPZDHYMKBHDQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(-n2c(C)c(C)c(C#N)c2N)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |