Benzeneacetic acid,4-(butoxycarbonyl)-,butyl ester
Modify Date: 2026-07-04 09:36:19
Benzeneacetic acid,4-(butoxycarbonyl)-,butyl ester structure
|
Common Name | Benzeneacetic acid,4-(butoxycarbonyl)-,butyl ester | ||
|---|---|---|---|---|
| CAS Number | 7259-97-4 | Molecular Weight | 292.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzeneacetic acid,4-(butoxycarbonyl)-,butyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H24O4 |
|---|---|
| Molecular Weight | 292.4 |
| InChIKey | MNYRYDQMTDILGB-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)Cc1ccc(C(=O)OCCCC)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Benzeneacetic acid,4-(butoxycarbonyl)-,butyl ester? |
| A: InChIKey of Benzeneacetic acid,4-(butoxycarbonyl)-,butyl ester is MNYRYDQMTDILGB-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Benzeneacetic acid,4-(butoxycarbonyl)-,butyl ester? |
| A: SMILES notation of Benzeneacetic acid,4-(butoxycarbonyl)-,butyl ester is CCCCOC(=O)Cc1ccc(C(=O)OCCCC)cc1. |
| Q: What is the molecular formula of Benzeneacetic acid,4-(butoxycarbonyl)-,butyl ester? |
| A: Molecular formula of Benzeneacetic acid,4-(butoxycarbonyl)-,butyl ester is C17H24O4. |
| Q: What is the Chinese name of 7259-97-4? |
| A: Chinese name of 7259-97-4 is 7259-97-4. |
| Q: What is the English name of Benzeneacetic acid,4-(butoxycarbonyl)-,butyl ester? |
| A: The English name of Benzeneacetic acid,4-(butoxycarbonyl)-,butyl ester is Benzeneacetic acid,4-(butoxycarbonyl)-,butyl ester. |
| Q: What is the molecular weight of Benzeneacetic acid,4-(butoxycarbonyl)-,butyl ester? |
| A: Molecular weight of Benzeneacetic acid,4-(butoxycarbonyl)-,butyl ester is 292.4. |
| Q: What is the CAS number of Benzeneacetic acid,4-(butoxycarbonyl)-,butyl ester? |
| A: CAS number of Benzeneacetic acid,4-(butoxycarbonyl)-,butyl ester is 7259-97-4. |