2-methylhept-1-en-3-ylsulfonylbenzene structure
|
Common Name | 2-methylhept-1-en-3-ylsulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 72592-56-4 | Molecular Weight | 252.37200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methylhept-1-en-3-ylsulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20O2S |
|---|---|
| Molecular Weight | 252.37200 |
| Exact Mass | 252.11800 |
| PSA | 42.52000 |
| LogP | 4.67600 |
| InChIKey | RTGVIPNVJBVHJO-UHFFFAOYSA-N |
| SMILES | C=C(C)C(CCCC)S(=O)(=O)c1ccccc1 |
|
~87%
2-methylhept-1-... CAS#:72592-56-4 |
| Literature: Trost,B.M.; Schmuff,N.R. Journal of the American Chemical Society, 1985 , vol. 107, p. 396 |
|
~%
2-methylhept-1-... CAS#:72592-56-4 |
| Literature: Trost,B.M.; Schmuff,N.R. Journal of the American Chemical Society, 1985 , vol. 107, p. 396 |
| Benzene,[[1-(1-methylethenyl)pentyl]sulfonyl] |
| phenylsulfonyl-3 methyl-2 heptene-1 |
| 2-methyl-3-(phenylsulfonyl)-1-heptene |