1-(4-chlorophenyl)sulfanylethenyl-trimethylsilane structure
|
Common Name | 1-(4-chlorophenyl)sulfanylethenyl-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 72622-67-4 | Molecular Weight | 242.84000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15ClSSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-chlorophenyl)sulfanylethenyl-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H15ClSSi |
|---|---|
| Molecular Weight | 242.84000 |
| Exact Mass | 242.03500 |
| PSA | 25.30000 |
| LogP | 4.82320 |
| InChIKey | SLVYVLOSJVQDLB-UHFFFAOYSA-N |
| SMILES | C=C(Sc1ccc(Cl)cc1)[Si](C)(C)C |
|
~79%
1-(4-chlorophen... CAS#:72622-67-4 |
| Literature: Cooke, Frank; Moerck, Rudi; Schwindeman, James; Magnus, Phillip Journal of Organic Chemistry, 1980 , vol. 45, # 6 p. 1046 - 1053 |
|
~%
1-(4-chlorophen... CAS#:72622-67-4 |
| Literature: Cooke, Frank; Moerck, Rudi; Schwindeman, James; Magnus, Phillip Journal of Organic Chemistry, 1980 , vol. 45, # 6 p. 1046 - 1053 |
|
~%
1-(4-chlorophen... CAS#:72622-67-4 |
| Literature: Cooke, Frank; Moerck, Rudi; Schwindeman, James; Magnus, Phillip Journal of Organic Chemistry, 1980 , vol. 45, # 6 p. 1046 - 1053 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Silane,[1-[(4-chlorophenyl)thio]ethenyl]trimethyl |
| 1-(trimethylsilyl)-1-<(4-chlorophenyl)thio>ethylene |
| 1-(trimethylsilyl)-1-(p-chlorophenylthio)ethylene |