1-(4,6-DIAMINO-1,3,5-TRIAZIN-2-YL)PIPERIDIN-4-OL structure
|
Common Name | 1-(4,6-DIAMINO-1,3,5-TRIAZIN-2-YL)PIPERIDIN-4-OL | ||
|---|---|---|---|---|
| CAS Number | 72652-34-7 | Molecular Weight | 254.49800 | |
| Density | 1.542g/cm3 | Boiling Point | 383.1ºC at 760 mmHg | |
| Molecular Formula | C8H6Cl3NO2 | Melting Point | 201-203ºC | |
| MSDS | N/A | Flash Point | 185.5ºC | |
| Name | 1-(4-acetyl-1H-pyrrol-2-yl)-2,2,2-trichloroethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.542g/cm3 |
|---|---|
| Boiling Point | 383.1ºC at 760 mmHg |
| Melting Point | 201-203ºC |
| Molecular Formula | C8H6Cl3NO2 |
| Molecular Weight | 254.49800 |
| Flash Point | 185.5ºC |
| Exact Mass | 252.94600 |
| PSA | 49.93000 |
| LogP | 2.77020 |
| Index of Refraction | 1.584 |
| InChIKey | OEXMOGNTZJXVPZ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c[nH]c(C(=O)C(Cl)(Cl)Cl)c1 |
| HS Code | 2933990090 |
|---|
|
~98%
1-(4,6-DIAMINO-... CAS#:72652-34-7 |
| Literature: Tani; Ariyasu; Nishiyama; Hagiwara; Watanabe; Yokoyama; Murakami Chemical and Pharmaceutical Bulletin, 1996 , vol. 44, # 1 p. 48 - 54 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4-acetyl-1H-pyrrol-2-yl)-2,2,2-trichloro-1-ethanone |
| 2,2,2-trichloro-1,1'-pyrrole-2,4-diyl-bis-ethanone |
| 4-acetyl-2-trichloroacetylpyrrole |
| acetylpyrrolyltrichloroethanone |