4-amino-2-methylsulfanyl-5-nitrothiophene-3-carbonitrile structure
|
Common Name | 4-amino-2-methylsulfanyl-5-nitrothiophene-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 72668-16-7 | Molecular Weight | 215.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5N3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-amino-2-methylsulfanyl-5-nitrothiophene-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H5N3O2S2 |
|---|---|
| Molecular Weight | 215.25300 |
| Exact Mass | 214.98200 |
| PSA | 149.17000 |
| LogP | 2.93648 |
| InChIKey | HDKNPSPEDLDZLC-UHFFFAOYSA-N |
| SMILES | CSc1sc([N+](=O)[O-])c(N)c1C#N |
|
~55%
4-amino-2-methy... CAS#:72668-16-7 |
| Literature: Fishwick, Brian R.; Rowles, David K.; Stirling, Charles J. M. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1986 , p. 1171 - 1180 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Thiophenecarbonitrile,4-amino-2-(methylthio)-5-nitro |