Aristolochic acid III structure
|
Common Name | Aristolochic acid III | ||
|---|---|---|---|---|
| CAS Number | 7267-92-7 | Molecular Weight | 341.27 | |
| Density | 1.571g/cm3 | Boiling Point | 615.5ºC at 760 mmHg | |
| Molecular Formula | C17H11NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 326ºC | |
Use of Aristolochic acid IIIAristolochic acid III is a natural product that can be isolated from the leaves of Aristolochia debilis[1]. |
| Name | 10-methoxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Aristolochic acid III is a natural product that can be isolated from the leaves of Aristolochia debilis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.571g/cm3 |
|---|---|
| Boiling Point | 615.5ºC at 760 mmHg |
| Molecular Formula | C17H11NO7 |
| Molecular Weight | 341.27 |
| Flash Point | 326ºC |
| Exact Mass | 341.05400 |
| PSA | 110.81000 |
| LogP | 3.85990 |
| Index of Refraction | 1.747 |
| InChIKey | MYVJZUBEKPWUFP-UHFFFAOYSA-N |
| SMILES | COc1ccc2cc([N+](=O)[O-])c3c(C(=O)O)cc4c(c3c2c1)OCO4 |
| Phenanthro(3,4-d)-1,3-dioxole-5-carboxylic acid,10-methoxy-6-nitro |
| aristolochic acid III |
| 10-methoxy-6-nitro-phenanthro[3,4-d][1,3]dioxole-5-carboxylic acid |
| Aristolochiasaeure III = 3.4-Methylendioxy-6-methoxy-10-nitro-phenanthren-1-carbonsaeure |
| Aristolochiasaeure III |