1-ethyl-3-[4-(1-methyl-2,5-dioxo-pyrrolidin-3-yl)phenyl]-1-nitroso-urea structure
|
Common Name | 1-ethyl-3-[4-(1-methyl-2,5-dioxo-pyrrolidin-3-yl)phenyl]-1-nitroso-urea | ||
|---|---|---|---|---|
| CAS Number | 72676-67-6 | Molecular Weight | 304.30100 | |
| Density | 1.38g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H16N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-ethyl-3-[4-(1-methyl-2,5-dioxopyrrolidin-3-yl)phenyl]-1-nitrosourea |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.30100 |
| Exact Mass | 304.11700 |
| PSA | 99.15000 |
| LogP | 1.70500 |
| Index of Refraction | 1.639 |
| InChIKey | JJXWSLWHJYRYLD-UHFFFAOYSA-N |
| SMILES | CCN(N=O)C(=O)Nc1ccc(C2CC(=O)N(C)C2=O)cc1 |
|
~42%
1-ethyl-3-[4-(1... CAS#:72676-67-6 |
| Literature: Crider, A. Michael; Kolczynski, Thomas M.; Yates, Kathleen M. Journal of Medicinal Chemistry, 1980 , vol. 23, # 3 p. 324 - 326 |
|
~%
1-ethyl-3-[4-(1... CAS#:72676-67-6 |
| Literature: Crider, A. Michael; Kolczynski, Thomas M.; Yates, Kathleen M. Journal of Medicinal Chemistry, 1980 , vol. 23, # 3 p. 324 - 326 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |