3-[4-(1-methyl-2,5-dioxo-pyrrolidin-3-yl)phenyl]-1-nitroso-1-propyl-urea structure
|
Common Name | 3-[4-(1-methyl-2,5-dioxo-pyrrolidin-3-yl)phenyl]-1-nitroso-1-propyl-urea | ||
|---|---|---|---|---|
| CAS Number | 72676-68-7 | Molecular Weight | 318.32800 | |
| Density | 1.35g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H18N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[4-(1-methyl-2,5-dioxopyrrolidin-3-yl)phenyl]-1-nitroso-1-propylurea |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.32800 |
| Exact Mass | 318.13300 |
| PSA | 99.15000 |
| LogP | 2.09510 |
| Index of Refraction | 1.628 |
| InChIKey | HJYPXQZSBUGHJT-UHFFFAOYSA-N |
| SMILES | CCCN(N=O)C(=O)Nc1ccc(C2CC(=O)N(C)C2=O)cc1 |
|
~33%
3-[4-(1-methyl-... CAS#:72676-68-7 |
| Literature: Crider, A. Michael; Kolczynski, Thomas M.; Yates, Kathleen M. Journal of Medicinal Chemistry, 1980 , vol. 23, # 3 p. 324 - 326 |
|
~%
3-[4-(1-methyl-... CAS#:72676-68-7 |
| Literature: Crider, A. Michael; Kolczynski, Thomas M.; Yates, Kathleen M. Journal of Medicinal Chemistry, 1980 , vol. 23, # 3 p. 324 - 326 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |